About cyclohexanol;cyclohexyl 4-methylbenzenesulfonate
cyclohexanol;cyclohexyl 4-methylbenzenesulfonate (PubChem CID 159499351) has the molecular formula C19H30O4S
and a molecular weight of 354.51 g/mol. Its IUPAC name is cyclohexanol;cyclohexyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | cyclohexanol;cyclohexyl 4-methylbenzenesulfonate |
| PubChem CID | 159499351 |
| Molecular Formula | C19H30O4S |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | cyclohexanol;cyclohexyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCCCC2)cc1.OC1CCCCC1 |
| InChI | InChI=1S/C13H18O3S.C6H12O/c1-11-7-9-13(10-8-11)17(14,15)16-12-5-3-2-4-6-12;7-6-4-2-1-3-5-6/h7-10,12H,2-6H2,1H3;6-7H,1-5H2 |
| InChIKey | LZEMLOHXGFZWIK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanol;cyclohexyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanol;cyclohexyl 4-methylbenzenesulfonate?
The IUPAC name of cyclohexanol;cyclohexyl 4-methylbenzenesulfonate (CID 159499351) is cyclohexanol;cyclohexyl 4-methylbenzenesulfonate.
What is the SMILES notation for cyclohexanol;cyclohexyl 4-methylbenzenesulfonate?
The canonical SMILES for cyclohexanol;cyclohexyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC2CCCCC2)cc1.OC1CCCCC1.
What is the InChIKey of cyclohexanol;cyclohexyl 4-methylbenzenesulfonate?
The InChIKey is LZEMLOHXGFZWIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3S.C6H12O/c1-11-7-9-13(10-8-11)17(14,15)16-12-5-3-2-4-6-12;7-6-4-2-1-3-5-6/h7-10,12H,2-6H2,1H3;6-7H,1-5H2.
What are the key properties of cyclohexanol;cyclohexyl 4-methylbenzenesulfonate?
cyclohexanol;cyclohexyl 4-methylbenzenesulfonate has a molecular weight of 354.51 g/mol, XLogP of 4.34, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanol;cyclohexyl 4-methylbenzenesulfonate is sourced from PubChem (CID 159499351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).