C20H24O7S2 — CID 118071873
[4-hydroxy-3-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate (PubChem CID 118071873) has the molecular formula C20H24O7S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is [4-hydroxy-3-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [4-hydroxy-3-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118071873 |
| Molecular Formula | C20H24O7S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [4-hydroxy-3-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC(O)C(OS(=O)(=O)c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C20H24O7S2/c1-14-3-8-17(9-4-14)28(22,23)26-16-7-12-19(21)20(13-16)27-29(24,25)18-10-5-15(2)6-11-18/h3-6,8-11,16,19-21H,7,12-13H2,1-2H3 |
| InChIKey | VCCIXBZRXJTWQW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|