C13H15ClO4S — CID 87415206
[(1S,2S)-3-chloro-2-hydroxycyclohex-3-en-1-yl] 4-methylbenzenesulfonate (PubChem CID 87415206) has the molecular formula C13H15ClO4S and a molecular weight of 302.78 g/mol. Its IUPAC name is [(1S,2S)-3-chloro-2-hydroxycyclohex-3-en-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2S)-3-chloro-2-hydroxycyclohex-3-en-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87415206 |
| Molecular Formula | C13H15ClO4S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | [(1S,2S)-3-chloro-2-hydroxycyclohex-3-en-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CCC=C(Cl)[C@H]2O)cc1 |
| InChI | InChI=1S/C13H15ClO4S/c1-9-5-7-10(8-6-9)19(16,17)18-12-4-2-3-11(14)13(12)15/h3,5-8,12-13,15H,2,4H2,1H3/t12-,13+/m0/s1 |
| InChIKey | WPDHURPZSYPSDU-QWHCGFSZSA-N |
| XLogP | 2.35 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|