C18H20O8S3 — CID 98121390
[(3S,4S)-4-(4-methylphenyl)sulfonyloxy-1,1-dioxothiolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 98121390) has the molecular formula C18H20O8S3 and a molecular weight of 460.55 g/mol. Its IUPAC name is [(3S,4S)-4-(4-methylphenyl)sulfonyloxy-1,1-dioxothiolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3S,4S)-4-(4-methylphenyl)sulfonyloxy-1,1-dioxothiolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 98121390 |
| Molecular Formula | C18H20O8S3 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | [(3S,4S)-4-(4-methylphenyl)sulfonyloxy-1,1-dioxothiolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CS(=O)(=O)C[C@H]2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H20O8S3/c1-13-3-7-15(8-4-13)28(21,22)25-17-11-27(19,20)12-18(17)26-29(23,24)16-9-5-14(2)6-10-16/h3-10,17-18H,11-12H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | UHHBSQIQMCEMON-QZTJIDSGSA-N |
| XLogP | 1.58 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|