C16H16O8S3 — CID 98117157
[(3S,4S)-4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate (PubChem CID 98117157) has the molecular formula C16H16O8S3 and a molecular weight of 432.50 g/mol. Its IUPAC name is [(3S,4S)-4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate.
| Compound Name | [(3S,4S)-4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate |
|---|---|
| PubChem CID | 98117157 |
| Molecular Formula | C16H16O8S3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | [(3S,4S)-4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate |
| SMILES | O=S1(=O)C[C@@H](OS(=O)(=O)c2ccccc2)[C@H](OS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H16O8S3/c17-25(18)11-15(23-26(19,20)13-7-3-1-4-8-13)16(12-25)24-27(21,22)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2/t15-,16-/m1/s1 |
| InChIKey | CXJFKXKGNJXNJE-HZPDHXFCSA-N |
| XLogP | 0.96 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|