C14H14O6S2 — CID 7658839
[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl] naphthalene-2-sulfonate (PubChem CID 7658839) has the molecular formula C14H14O6S2 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl] naphthalene-2-sulfonate.
| Compound Name | [(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl] naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 7658839 |
| Molecular Formula | C14H14O6S2 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | [(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl] naphthalene-2-sulfonate |
| SMILES | O=S1(=O)C[C@H](OS(=O)(=O)c2ccc3ccccc3c2)[C@@H](O)C1 |
| InChI | InChI=1S/C14H14O6S2/c15-13-8-21(16,17)9-14(13)20-22(18,19)12-6-5-10-3-1-2-4-11(10)7-12/h1-7,13-15H,8-9H2/t13-,14-/m0/s1 |
| InChIKey | UVLCCZAPIPLCCQ-KBPBESRZSA-N |
| XLogP | 0.70 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|