C20H20O8S3 — CID 18801594
[4-(4-ethenylphenyl)sulfonyloxy-1,1-dioxothiolan-3-yl] 4-ethenylbenzenesulfonate (PubChem CID 18801594) has the molecular formula C20H20O8S3 and a molecular weight of 484.57 g/mol. Its IUPAC name is [4-(4-ethenylphenyl)sulfonyloxy-1,1-dioxothiolan-3-yl] 4-ethenylbenzenesulfonate.
| Compound Name | [4-(4-ethenylphenyl)sulfonyloxy-1,1-dioxothiolan-3-yl] 4-ethenylbenzenesulfonate |
|---|---|
| PubChem CID | 18801594 |
| Molecular Formula | C20H20O8S3 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | [4-(4-ethenylphenyl)sulfonyloxy-1,1-dioxothiolan-3-yl] 4-ethenylbenzenesulfonate |
| SMILES | C=Cc1ccc(S(=O)(=O)OC2CS(=O)(=O)CC2OS(=O)(=O)c2ccc(C=C)cc2)cc1 |
| InChI | InChI=1S/C20H20O8S3/c1-3-15-5-9-17(10-6-15)30(23,24)27-19-13-29(21,22)14-20(19)28-31(25,26)18-11-7-16(4-2)8-12-18/h3-12,19-20H,1-2,13-14H2 |
| InChIKey | ZZOQINMDFROUAG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|