C18H26O3S — CID 59886152
[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-ethenylbenzenesulfonate (PubChem CID 59886152) has the molecular formula C18H26O3S and a molecular weight of 322.47 g/mol. Its IUPAC name is [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-ethenylbenzenesulfonate.
| Compound Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-ethenylbenzenesulfonate |
|---|---|
| PubChem CID | 59886152 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-ethenylbenzenesulfonate |
| SMILES | C=Cc1ccc(S(=O)(=O)OC2C[C@H](C)CC[C@H]2C(C)C)cc1 |
| InChI | InChI=1S/C18H26O3S/c1-5-15-7-9-16(10-8-15)22(19,20)21-18-12-14(4)6-11-17(18)13(2)3/h5,7-10,13-14,17-18H,1,6,11-12H2,2-4H3/t14-,17+,18?/m1/s1 |
| InChIKey | FFQNXECXFJWSDF-NAVMLSPISA-N |
| XLogP | 4.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|