C15H24O3S — CID 101180673
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] cyclopenta-2,4-diene-1-sulfonate (PubChem CID 101180673) has the molecular formula C15H24O3S and a molecular weight of 284.42 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] cyclopenta-2,4-diene-1-sulfonate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] cyclopenta-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 101180673 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] cyclopenta-2,4-diene-1-sulfonate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OS(=O)(=O)C1C=CC=C1 |
| InChI | InChI=1S/C15H24O3S/c1-11(2)14-9-8-12(3)10-15(14)18-19(16,17)13-6-4-5-7-13/h4-7,11-15H,8-10H2,1-3H3/t12-,14+,15-/m1/s1 |
| InChIKey | DHWHFTYOTVQMRF-VHDGCEQUSA-N |
| XLogP | 3.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|