[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid

C10H21BO3 — CID 99738331

IUPAC[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid
SMILESCC(C)[C@H]1CC[C@H](C)C[C@@H]1OB(O)O
InChIInChI=1S/C10H21BO3/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10,12-13H,4-6H2,1-3H3/t8-,9+,10-/m0/s1
InChIKeyGNMGRDDGGNNGPH-AEJSXWLSSA-N
MW200.09 g/mol
LogP1.43
Rot. Bonds3

About [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid

[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid (PubChem CID 99738331) has the molecular formula C10H21BO3 and a molecular weight of 200.09 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid.

Molecular Properties

Compound Name[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid
PubChem CID99738331
Molecular FormulaC10H21BO3
Molecular Weight200.09 g/mol
Exact Mass200.16
IUPAC Name[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid
SMILESCC(C)[C@H]1CC[C@H](C)C[C@@H]1OB(O)O
InChIInChI=1S/C10H21BO3/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10,12-13H,4-6H2,1-3H3/t8-,9+,10-/m0/s1
InChIKeyGNMGRDDGGNNGPH-AEJSXWLSSA-N
XLogP1.43
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.09
LogP ≤ 51.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid?
The IUPAC name of [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid (CID 99738331) is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid.
What is the SMILES notation for [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid?
The canonical SMILES for [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid is CC(C)[C@H]1CC[C@H](C)C[C@@H]1OB(O)O.
What is the InChIKey of [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid?
The InChIKey is GNMGRDDGGNNGPH-AEJSXWLSSA-N. The full InChI is InChI=1S/C10H21BO3/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10,12-13H,4-6H2,1-3H3/t8-,9+,10-/m0/s1.
What are the key properties of [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid?
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid has a molecular weight of 200.09 g/mol, XLogP of 1.43, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyboronic acid is sourced from PubChem (CID 99738331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).