C20H38O2S2 — CID 70687940
(1R,2S,4S)-4-methyl-2-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxydisulfanyl]oxy-1-propan-2-ylcyclohexane (PubChem CID 70687940) has the molecular formula C20H38O2S2 and a molecular weight of 374.66 g/mol. Its IUPAC name is (1R,2S,4S)-4-methyl-2-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxydisulfanyl]oxy-1-propan-2-ylcyclohexane.
| Compound Name | (1R,2S,4S)-4-methyl-2-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxydisulfanyl]oxy-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 70687940 |
| Molecular Formula | C20H38O2S2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (1R,2S,4S)-4-methyl-2-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxydisulfanyl]oxy-1-propan-2-ylcyclohexane |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OSSO[C@H]1C[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C20H38O2S2/c1-13(2)17-9-7-15(5)11-19(17)21-23-24-22-20-12-16(6)8-10-18(20)14(3)4/h13-20H,7-12H2,1-6H3/t15-,16-,17+,18+,19-,20-/m0/s1 |
| InChIKey | ZTQOUQGOZHUYNV-GTYQWKCWSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|