C10H19AlCl2O — CID 16695980
dichloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyalumane (PubChem CID 16695980) has the molecular formula C10H19AlCl2O and a molecular weight of 253.15 g/mol. Its IUPAC name is dichloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyalumane.
| Compound Name | dichloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyalumane |
|---|---|
| PubChem CID | 16695980 |
| Molecular Formula | C10H19AlCl2O |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | dichloro-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyalumane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[Al](Cl)Cl |
| InChI | InChI=1S/C10H19O.Al.2ClH/c1-7(2)9-5-4-8(3)6-10(9)11;;;/h7-10H,4-6H2,1-3H3;;2*1H/q-1;+3;;/p-2/t8-,9+,10-;;;/m1.../s1 |
| InChIKey | JQCVRBYBLQPAEI-CEBLYQJUSA-L |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |