C11H19ClO2 — CID 13308514
[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate (PubChem CID 13308514) has the molecular formula C11H19ClO2 and a molecular weight of 218.72 g/mol. Its IUPAC name is [(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate.
| Compound Name | [(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate |
|---|---|
| PubChem CID | 13308514 |
| Molecular Formula | C11H19ClO2 |
| Molecular Weight | 218.72 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | [(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1OC(=O)Cl |
| InChI | InChI=1S/C11H19ClO2/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10H,4-6H2,1-3H3/t8-,9-,10-/m1/s1 |
| InChIKey | KIUPCUCGVCGPPA-OPRDCNLKSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|