C24H38O4 — CID 11868487
bis[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] but-2-ynedioate (PubChem CID 11868487) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is bis[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] but-2-ynedioate.
| Compound Name | bis[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] but-2-ynedioate |
|---|---|
| PubChem CID | 11868487 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | bis[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] but-2-ynedioate |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1OC(=O)C#CC(=O)O[C@@H]1C[C@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C24H38O4/c1-15(2)19-9-7-17(5)13-21(19)27-23(25)11-12-24(26)28-22-14-18(6)8-10-20(22)16(3)4/h15-22H,7-10,13-14H2,1-6H3/t17-,18-,19-,20-,21-,22-/m1/s1 |
| InChIKey | FFEDBGCLGPHNIL-CGXUPHRESA-N |
| XLogP | 5.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|