About [(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate
[(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate (PubChem CID 90138995) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is [(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate.
Analyze [(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate?
The IUPAC name of [(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate (CID 90138995) is [(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate.
What is the SMILES notation for [(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate?
The canonical SMILES for [(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate is CC(C)C(=O)O[C@H]1C[C@@H](C)CCC1C(C)C.
What is the InChIKey of [(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate?
The InChIKey is CSZKNSMAMITXAD-RXTYADHFSA-N. The full InChI is InChI=1S/C14H26O2/c1-9(2)12-7-6-11(5)8-13(12)16-14(15)10(3)4/h9-13H,6-8H2,1-5H3/t11-,12?,13-/m0/s1.
What are the key properties of [(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate?
[(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate has a molecular weight of 226.36 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylpropanoate is sourced from PubChem (CID 90138995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).