C15H26O3 — CID 156702086
(5-methyl-2-propan-2-ylcyclohexyl) 2-methyl-3-oxobutanoate (PubChem CID 156702086) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-methyl-3-oxobutanoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 156702086 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-methyl-3-oxobutanoate |
| SMILES | CC(=O)C(C)C(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C15H26O3/c1-9(2)13-7-6-10(3)8-14(13)18-15(17)11(4)12(5)16/h9-11,13-14H,6-8H2,1-5H3 |
| InChIKey | PRYBXZOLOBDLGE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|