C22H36O6 — CID 2750823
1-O-ethyl 5-O-(5-methyl-2-propan-2-ylcyclohexyl) 2,4-diacetyl-3-methylpentanedioate (PubChem CID 2750823) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-O-ethyl 5-O-(5-methyl-2-propan-2-ylcyclohexyl) 2,4-diacetyl-3-methylpentanedioate.
| Compound Name | 1-O-ethyl 5-O-(5-methyl-2-propan-2-ylcyclohexyl) 2,4-diacetyl-3-methylpentanedioate |
|---|---|
| PubChem CID | 2750823 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 1-O-ethyl 5-O-(5-methyl-2-propan-2-ylcyclohexyl) 2,4-diacetyl-3-methylpentanedioate |
| SMILES | CCOC(=O)C(C(C)=O)C(C)C(C(C)=O)C(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C22H36O6/c1-8-27-21(25)19(15(6)23)14(5)20(16(7)24)22(26)28-18-11-13(4)9-10-17(18)12(2)3/h12-14,17-20H,8-11H2,1-7H3 |
| InChIKey | PFRRINIMSRUQHA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|