C23H39N3O6 — CID 98102467
[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3R,4R)-2-acetyl-4-[(E)-N-(carbamoylamino)-C-ethoxycarbonimidoyl]-3-methyl-5-oxohexanoate (PubChem CID 98102467) has the molecular formula C23H39N3O6 and a molecular weight of 453.58 g/mol. Its IUPAC name is [(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3R,4R)-2-acetyl-4-[(E)-N-(carbamoylamino)-C-ethoxycarbonimidoyl]-3-methyl-5-oxohexanoate.
| Compound Name | [(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3R,4R)-2-acetyl-4-[(E)-N-(carbamoylamino)-C-ethoxycarbonimidoyl]-3-methyl-5-oxohexanoate |
|---|---|
| PubChem CID | 98102467 |
| Molecular Formula | C23H39N3O6 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | [(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3R,4R)-2-acetyl-4-[(E)-N-(carbamoylamino)-C-ethoxycarbonimidoyl]-3-methyl-5-oxohexanoate |
| SMILES | CCO/C(=N/NC(N)=O)[C@H](C(C)=O)[C@@H](C)[C@@H](C(C)=O)C(=O)O[C@@H]1C[C@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C23H39N3O6/c1-8-31-21(25-26-23(24)30)19(15(6)27)14(5)20(16(7)28)22(29)32-18-11-13(4)9-10-17(18)12(2)3/h12-14,17-20H,8-11H2,1-7H3,(H3,24,26,30)/b25-21+/t13-,14-,17-,18-,19+,20+/m1/s1 |
| InChIKey | HAHWMQFIDWVHBU-YLZGCRRNSA-N |
| XLogP | 3.06 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|