C12H21BrO2 — CID 172731984
[(5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-bromoacetate (PubChem CID 172731984) has the molecular formula C12H21BrO2 and a molecular weight of 277.20 g/mol. Its IUPAC name is [(5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-bromoacetate.
| Compound Name | [(5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-bromoacetate |
|---|---|
| PubChem CID | 172731984 |
| Molecular Formula | C12H21BrO2 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [(5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-bromoacetate |
| SMILES | CC(C)C1CC[C@@H](C)CC1OC(=O)CBr |
| InChI | InChI=1S/C12H21BrO2/c1-8(2)10-5-4-9(3)6-11(10)15-12(14)7-13/h8-11H,4-7H2,1-3H3/t9-,10?,11?/m1/s1 |
| InChIKey | HXNXZTLLFFEGBK-KPPDAEKUSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|