C14H23O4- — CID 18676664
4-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxobutanoate (PubChem CID 18676664) has the molecular formula C14H23O4- and a molecular weight of 255.33 g/mol. Its IUPAC name is 4-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxobutanoate.
| Compound Name | 4-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxobutanoate |
|---|---|
| PubChem CID | 18676664 |
| Molecular Formula | C14H23O4- |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxobutanoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)CCC(=O)[O-])C1 |
| InChI | InChI=1S/C14H24O4/c1-9(2)11-5-4-10(3)8-12(11)18-14(17)7-6-13(15)16/h9-12H,4-8H2,1-3H3,(H,15,16)/p-1 |
| InChIKey | BLILOGGUTRWFNI-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |