C53H92O12 — CID 175337786
bis(bis(5-methyl-2-propan-2-ylcyclohexyl) butanedioate);pentanedioic acid (PubChem CID 175337786) has the molecular formula C53H92O12 and a molecular weight of 921.31 g/mol. Its IUPAC name is bis(bis(5-methyl-2-propan-2-ylcyclohexyl) butanedioate);pentanedioic acid.
| Compound Name | bis(bis(5-methyl-2-propan-2-ylcyclohexyl) butanedioate);pentanedioic acid |
|---|---|
| PubChem CID | 175337786 |
| Molecular Formula | C53H92O12 |
| Molecular Weight | 921.31 g/mol |
| Exact Mass | 920.66 |
| IUPAC Name | bis(bis(5-methyl-2-propan-2-ylcyclohexyl) butanedioate);pentanedioic acid |
| SMILES | CC1CCC(C(C)C)C(OC(=O)CCC(=O)OC2CC(C)CCC2C(C)C)C1.CC1CCC(C(C)C)C(OC(=O)CCC(=O)OC2CC(C)CCC2C(C)C)C1.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/2C24H42O4.C5H8O4/c2*1-15(2)19-9-7-17(5)13-21(19)27-23(25)11-12-24(26)28-22-14-18(6)8-10-20(22)16(3)4;6-4(7)2-1-3-5(8)9/h2*15-22H,7-14H2,1-6H3;1-3H2,(H,6,7)(H,8,9) |
| InChIKey | JOTKVEMIXCJXNL-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.31 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|