C17H30O3 — CID 20778190
(5-methyl-2-propan-2-ylcyclohexyl) 6-oxoheptanoate (PubChem CID 20778190) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 6-oxoheptanoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 6-oxoheptanoate |
|---|---|
| PubChem CID | 20778190 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 6-oxoheptanoate |
| SMILES | CC(=O)CCCCC(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C17H30O3/c1-12(2)15-10-9-13(3)11-16(15)20-17(19)8-6-5-7-14(4)18/h12-13,15-16H,5-11H2,1-4H3 |
| InChIKey | CMPKSGIYLPNPKT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|