C16H30O3 — CID 155667718
(5-methyl-2-propan-2-ylcyclohexyl) 5-hydroxyhexanoate (PubChem CID 155667718) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 5-hydroxyhexanoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 5-hydroxyhexanoate |
|---|---|
| PubChem CID | 155667718 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 5-hydroxyhexanoate |
| SMILES | CC(O)CCCC(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C16H30O3/c1-11(2)14-9-8-12(3)10-15(14)19-16(18)7-5-6-13(4)17/h11-15,17H,5-10H2,1-4H3 |
| InChIKey | XXXULKMSHYIODF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |