C21H36O2 — CID 102469083
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] undec-10-ynoate (PubChem CID 102469083) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] undec-10-ynoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] undec-10-ynoate |
|---|---|
| PubChem CID | 102469083 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] undec-10-ynoate |
| SMILES | C#CCCCCCCCCC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C21H36O2/c1-5-6-7-8-9-10-11-12-13-21(22)23-20-16-18(4)14-15-19(20)17(2)3/h1,17-20H,6-16H2,2-4H3/t18-,19+,20-/m1/s1 |
| InChIKey | OHMPKSFFEYWQGJ-HSALFYBXSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|