C23H40O4 — CID 14226058
bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] propanedioate (PubChem CID 14226058) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] propanedioate.
| Compound Name | bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] propanedioate |
|---|---|
| PubChem CID | 14226058 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] propanedioate |
| SMILES | CC(C)C1CC[C@@H](C)C[C@H]1OC(=O)CC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C23H40O4/c1-14(2)18-9-7-16(5)11-20(18)26-22(24)13-23(25)27-21-12-17(6)8-10-19(21)15(3)4/h14-21H,7-13H2,1-6H3/t16-,17-,18+,19?,20-,21-/m1/s1 |
| InChIKey | DXIMSSOEQPVPJZ-SJZUESHLSA-N |
| XLogP | 5.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|