C15H31ClNO2+ — CID 11403605
trimethyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl]azanium;hydrochloride (PubChem CID 11403605) has the molecular formula C15H31ClNO2+ and a molecular weight of 292.87 g/mol. Its IUPAC name is trimethyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl]azanium;hydrochloride.
| Compound Name | trimethyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl]azanium;hydrochloride |
|---|---|
| PubChem CID | 11403605 |
| Molecular Formula | C15H31ClNO2+ |
| Molecular Weight | 292.87 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | trimethyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl]azanium;hydrochloride |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)C[N+](C)(C)C.Cl |
| InChI | InChI=1S/C15H30NO2.ClH/c1-11(2)13-8-7-12(3)9-14(13)18-15(17)10-16(4,5)6;/h11-14H,7-10H2,1-6H3;1H/q+1;/t12-,13+,14-;/m1./s1 |
| InChIKey | KWZXWPDGKZYNGM-FPFZOWOXSA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.87 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|