C18H36NO2+ — CID 22435804
butyl-dimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]azanium (PubChem CID 22435804) has the molecular formula C18H36NO2+ and a molecular weight of 298.49 g/mol. Its IUPAC name is butyl-dimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]azanium.
| Compound Name | butyl-dimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 22435804 |
| Molecular Formula | C18H36NO2+ |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | butyl-dimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]azanium |
| SMILES | CCCC[N+](C)(C)CC(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C18H36NO2/c1-7-8-11-19(5,6)13-18(20)21-17-12-15(4)9-10-16(17)14(2)3/h14-17H,7-13H2,1-6H3/q+1 |
| InChIKey | XZHNPSLHNNKCFR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|