C18H37N2O2+ — CID 58592313
2-(dimethylamino)ethyl-dimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]azanium (PubChem CID 58592313) has the molecular formula C18H37N2O2+ and a molecular weight of 313.51 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl-dimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]azanium.
| Compound Name | 2-(dimethylamino)ethyl-dimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 58592313 |
| Molecular Formula | C18H37N2O2+ |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | 2-(dimethylamino)ethyl-dimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]azanium |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C[N+](C)(C)CCN(C)C)C1 |
| InChI | InChI=1S/C18H37N2O2/c1-14(2)16-9-8-15(3)12-17(16)22-18(21)13-20(6,7)11-10-19(4)5/h14-17H,8-13H2,1-7H3/q+1 |
| InChIKey | WSAQFDMWJWXSPD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|