C13H24O3 — CID 175905801
[(1S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methoxyacetate (PubChem CID 175905801) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is [(1S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methoxyacetate.
| Compound Name | [(1S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 175905801 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | [(1S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@H]1C[C@H](C)CCC1C(C)C |
| InChI | InChI=1S/C13H24O3/c1-9(2)11-6-5-10(3)7-12(11)16-13(14)8-15-4/h9-12H,5-8H2,1-4H3/t10-,11?,12+/m1/s1 |
| InChIKey | YUSYUWOMPYRVGF-LWALXPGCSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |