C28H46O9 — CID 139246700
bis[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (2R)-2-hydroxybutanedioate (PubChem CID 139246700) has the molecular formula C28H46O9 and a molecular weight of 526.67 g/mol. Its IUPAC name is bis[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (2R)-2-hydroxybutanedioate.
| Compound Name | bis[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (2R)-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 139246700 |
| Molecular Formula | C28H46O9 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | bis[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (2R)-2-hydroxybutanedioate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)COC(=O)C[C@@H](O)C(=O)OCC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C28H46O9/c1-16(2)20-9-7-18(5)11-23(20)36-26(31)14-34-25(30)13-22(29)28(33)35-15-27(32)37-24-12-19(6)8-10-21(24)17(3)4/h16-24,29H,7-15H2,1-6H3/t18-,19-,20+,21+,22-,23-,24-/m1/s1 |
| InChIKey | HIGCLTRMFTZZLH-LWZZWOPWSA-N |
| XLogP | 3.83 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|