C13H21NO2 — CID 2750806
(5-methyl-2-propan-2-ylcyclohexyl) 2-cyanoacetate (PubChem CID 2750806) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-cyanoacetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-cyanoacetate |
|---|---|
| PubChem CID | 2750806 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-cyanoacetate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)CC#N)C1 |
| InChI | InChI=1S/C13H21NO2/c1-9(2)11-5-4-10(3)8-12(11)16-13(15)6-7-14/h9-12H,4-6,8H2,1-3H3 |
| InChIKey | KCZNYQIXVJEFPW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |