C17H31BrO2 — CID 170657865
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-(bromomethyl)hexanoate (PubChem CID 170657865) has the molecular formula C17H31BrO2 and a molecular weight of 347.34 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-(bromomethyl)hexanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-(bromomethyl)hexanoate |
|---|---|
| PubChem CID | 170657865 |
| Molecular Formula | C17H31BrO2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-(bromomethyl)hexanoate |
| SMILES | CCCC(CBr)CC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C17H31BrO2/c1-5-6-14(11-18)10-17(19)20-16-9-13(4)7-8-15(16)12(2)3/h12-16H,5-11H2,1-4H3/t13-,14?,15+,16-/m1/s1 |
| InChIKey | FSJAYGCRNYMAFN-HEWHGDCOSA-N |
| XLogP | 5.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|