C16H31NO2 — CID 104686009
(5-methyl-2-propan-2-ylcyclohexyl) 5-amino-2-methylpentanoate (PubChem CID 104686009) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 5-amino-2-methylpentanoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 5-amino-2-methylpentanoate |
|---|---|
| PubChem CID | 104686009 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 5-amino-2-methylpentanoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C(C)CCCN)C1 |
| InChI | InChI=1S/C16H31NO2/c1-11(2)14-8-7-12(3)10-15(14)19-16(18)13(4)6-5-9-17/h11-15H,5-10,17H2,1-4H3 |
| InChIKey | WXMBPMRBSAYLKL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |