C18H35NO2 — CID 65285377
(5-methyl-2-propan-2-ylcyclohexyl) 6-amino-2-methylheptanoate (PubChem CID 65285377) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 6-amino-2-methylheptanoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 6-amino-2-methylheptanoate |
|---|---|
| PubChem CID | 65285377 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 6-amino-2-methylheptanoate |
| SMILES | CC(N)CCCC(C)C(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C18H35NO2/c1-12(2)16-10-9-13(3)11-17(16)21-18(20)14(4)7-6-8-15(5)19/h12-17H,6-11,19H2,1-5H3 |
| InChIKey | NUHWJICMVHDIGV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |