C19H24O2 — CID 2750811
(5-methyl-2-propan-2-ylcyclohexyl) 3-phenylprop-2-ynoate (PubChem CID 2750811) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 3-phenylprop-2-ynoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-phenylprop-2-ynoate |
|---|---|
| PubChem CID | 2750811 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-phenylprop-2-ynoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C#Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H24O2/c1-14(2)17-11-9-15(3)13-18(17)21-19(20)12-10-16-7-5-4-6-8-16/h4-8,14-15,17-18H,9,11,13H2,1-3H3 |
| InChIKey | WDOZQXWWPJRUPB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|