C17H23ClO2 — CID 71594437
(5-methyl-2-propan-2-ylcyclohexyl) 2-chlorobenzoate (PubChem CID 71594437) has the molecular formula C17H23ClO2 and a molecular weight of 294.82 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-chlorobenzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-chlorobenzoate |
|---|---|
| PubChem CID | 71594437 |
| Molecular Formula | C17H23ClO2 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-chlorobenzoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C17H23ClO2/c1-11(2)13-9-8-12(3)10-16(13)20-17(19)14-6-4-5-7-15(14)18/h4-7,11-13,16H,8-10H2,1-3H3 |
| InChIKey | ZUIFMWSKJRWNKP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |