C18H27NO2 — CID 63446666
(5-methyl-2-propan-2-ylcyclohexyl) 3-amino-2-methylbenzoate (PubChem CID 63446666) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 3-amino-2-methylbenzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-amino-2-methylbenzoate |
|---|---|
| PubChem CID | 63446666 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-amino-2-methylbenzoate |
| SMILES | Cc1c(N)cccc1C(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C18H27NO2/c1-11(2)14-9-8-12(3)10-17(14)21-18(20)15-6-5-7-16(19)13(15)4/h5-7,11-12,14,17H,8-10,19H2,1-4H3 |
| InChIKey | UFZYZYFIRMBFLS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|