C34H48N2O4Se2 — CID 170519195
(5-methyl-2-propan-2-ylcyclohexyl) 2-amino-5-[[4-amino-3-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl]diselanyl]benzoate (PubChem CID 170519195) has the molecular formula C34H48N2O4Se2 and a molecular weight of 706.69 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-amino-5-[[4-amino-3-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl]diselanyl]benzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-amino-5-[[4-amino-3-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl]diselanyl]benzoate |
|---|---|
| PubChem CID | 170519195 |
| Molecular Formula | C34H48N2O4Se2 |
| Molecular Weight | 706.69 g/mol |
| Exact Mass | 708.19 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-amino-5-[[4-amino-3-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl]diselanyl]benzoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2cc([Se][Se]c3ccc(N)c(C(=O)OC4CC(C)CCC4C(C)C)c3)ccc2N)C1 |
| InChI | InChI=1S/C34H48N2O4Se2/c1-19(2)25-11-7-21(5)15-31(25)39-33(37)27-17-23(9-13-29(27)35)41-42-24-10-14-30(36)28(18-24)34(38)40-32-16-22(6)8-12-26(32)20(3)4/h9-10,13-14,17-22,25-26,31-32H,7-8,11-12,15-16,35-36H2,1-6H3 |
| InChIKey | JSNSEARAINNNSC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.69 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|