C17H22F2O2 — CID 63840761
(5-methyl-2-propan-2-ylcyclohexyl) 2,3-difluorobenzoate (PubChem CID 63840761) has the molecular formula C17H22F2O2 and a molecular weight of 296.36 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2,3-difluorobenzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2,3-difluorobenzoate |
|---|---|
| PubChem CID | 63840761 |
| Molecular Formula | C17H22F2O2 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2,3-difluorobenzoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2cccc(F)c2F)C1 |
| InChI | InChI=1S/C17H22F2O2/c1-10(2)12-8-7-11(3)9-15(12)21-17(20)13-5-4-6-14(18)16(13)19/h4-6,10-12,15H,7-9H2,1-3H3 |
| InChIKey | OMFKWEIKSCKURJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |