C24H31NO4S — CID 3572871
(5-methyl-2-propan-2-ylcyclohexyl) 2-[(4-methylphenyl)sulfonylamino]benzoate (PubChem CID 3572871) has the molecular formula C24H31NO4S and a molecular weight of 429.58 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-[(4-methylphenyl)sulfonylamino]benzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[(4-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 3572871 |
| Molecular Formula | C24H31NO4S |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[(4-methylphenyl)sulfonylamino]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2C(=O)OC2CC(C)CCC2C(C)C)cc1 |
| InChI | InChI=1S/C24H31NO4S/c1-16(2)20-14-11-18(4)15-23(20)29-24(26)21-7-5-6-8-22(21)25-30(27,28)19-12-9-17(3)10-13-19/h5-10,12-13,16,18,20,23,25H,11,14-15H2,1-4H3 |
| InChIKey | GZOOFSNLMAKYOY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |