C20H33NO2Si — CID 91731893
(5-methyl-2-propan-2-ylcyclohexyl) 2-(trimethylsilylamino)benzoate (PubChem CID 91731893) has the molecular formula C20H33NO2Si and a molecular weight of 347.58 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(trimethylsilylamino)benzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(trimethylsilylamino)benzoate |
|---|---|
| PubChem CID | 91731893 |
| Molecular Formula | C20H33NO2Si |
| Molecular Weight | 347.58 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(trimethylsilylamino)benzoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2ccccc2N[Si](C)(C)C)C1 |
| InChI | InChI=1S/C20H33NO2Si/c1-14(2)16-12-11-15(3)13-19(16)23-20(22)17-9-7-8-10-18(17)21-24(4,5)6/h7-10,14-16,19,21H,11-13H2,1-6H3 |
| InChIKey | AVLRQHMHFFAQKV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|