C26H34N2O7 — CID 55427482
(5-methyl-2-propan-2-ylcyclohexyl) 2-[[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoyloxy]acetyl]amino]benzoate (PubChem CID 55427482) has the molecular formula C26H34N2O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-[[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoyloxy]acetyl]amino]benzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoyloxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 55427482 |
| Molecular Formula | C26H34N2O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoyloxy]acetyl]amino]benzoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2ccccc2NC(=O)COC(=O)CCN2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C26H34N2O7/c1-16(2)18-9-8-17(3)14-21(18)35-26(33)19-6-4-5-7-20(19)27-22(29)15-34-25(32)12-13-28-23(30)10-11-24(28)31/h4-7,16-18,21H,8-15H2,1-3H3,(H,27,29) |
| InChIKey | UGFHQDIUWSSGIP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|