C21H32N2O3 — CID 166206981
N-ethyl-2-[[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]benzamide (PubChem CID 166206981) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-ethyl-2-[[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]benzamide.
| Compound Name | N-ethyl-2-[[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]benzamide |
|---|---|
| PubChem CID | 166206981 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | N-ethyl-2-[[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]benzamide |
| SMILES | CCNC(=O)c1ccccc1NC(=O)COC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C21H32N2O3/c1-5-22-21(25)17-8-6-7-9-18(17)23-20(24)13-26-19-12-15(4)10-11-16(19)14(2)3/h6-9,14-16,19H,5,10-13H2,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | SRCVDEXRKPHDAN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |