C21H34N2O4S — CID 47029916
N-[2-(benzylsulfonylamino)ethyl]-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetamide (PubChem CID 47029916) has the molecular formula C21H34N2O4S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-[2-(benzylsulfonylamino)ethyl]-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetamide.
| Compound Name | N-[2-(benzylsulfonylamino)ethyl]-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetamide |
|---|---|
| PubChem CID | 47029916 |
| Molecular Formula | C21H34N2O4S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-[2-(benzylsulfonylamino)ethyl]-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetamide |
| SMILES | CC1CCC(C(C)C)C(OCC(=O)NCCNS(=O)(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H34N2O4S/c1-16(2)19-10-9-17(3)13-20(19)27-14-21(24)22-11-12-23-28(25,26)15-18-7-5-4-6-8-18/h4-8,16-17,19-20,23H,9-15H2,1-3H3,(H,22,24) |
| InChIKey | AUCDQYDZGWXARU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|