C20H31NO4S — CID 167875838
2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-N-(1-phenylethylsulfonyl)acetamide (PubChem CID 167875838) has the molecular formula C20H31NO4S and a molecular weight of 381.54 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-N-(1-phenylethylsulfonyl)acetamide.
| Compound Name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-N-(1-phenylethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 167875838 |
| Molecular Formula | C20H31NO4S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-N-(1-phenylethylsulfonyl)acetamide |
| SMILES | CC1CCC(C(C)C)C(OCC(=O)NS(=O)(=O)C(C)c2ccccc2)C1 |
| InChI | InChI=1S/C20H31NO4S/c1-14(2)18-11-10-15(3)12-19(18)25-13-20(22)21-26(23,24)16(4)17-8-6-5-7-9-17/h5-9,14-16,18-19H,10-13H2,1-4H3,(H,21,22) |
| InChIKey | HRNGDXLVAAVUJP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |