C20H31NO2 — CID 70259462
(5-methyl-2-propan-2-ylcyclohexyl) 2-[[(1S)-1-phenylethyl]amino]acetate (PubChem CID 70259462) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-[[(1S)-1-phenylethyl]amino]acetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[[(1S)-1-phenylethyl]amino]acetate |
|---|---|
| PubChem CID | 70259462 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[[(1S)-1-phenylethyl]amino]acetate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)CN[C@@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C20H31NO2/c1-14(2)18-11-10-15(3)12-19(18)23-20(22)13-21-16(4)17-8-6-5-7-9-17/h5-9,14-16,18-19,21H,10-13H2,1-4H3/t15?,16-,18?,19?/m0/s1 |
| InChIKey | RMOCNWDYTAVXGF-WZNLIARSSA-N |
| XLogP | 4.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |