C21H32O2 — CID 59897726
[(2R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methyl-3-phenylbutanoate (PubChem CID 59897726) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is [(2R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methyl-3-phenylbutanoate.
| Compound Name | [(2R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methyl-3-phenylbutanoate |
|---|---|
| PubChem CID | 59897726 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | [(2R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methyl-3-phenylbutanoate |
| SMILES | CC1CC[C@H](C(C)C)C(OC(=O)C(C)C(C)c2ccccc2)C1 |
| InChI | InChI=1S/C21H32O2/c1-14(2)19-12-11-15(3)13-20(19)23-21(22)17(5)16(4)18-9-7-6-8-10-18/h6-10,14-17,19-20H,11-13H2,1-5H3/t15?,16?,17?,19-,20?/m1/s1 |
| InChIKey | WOZNMVXRZQOMSJ-OFGIBPIPSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |