C25H30O3 — CID 2750815
(5-methyl-2-propan-2-ylcyclohexyl) 3-oxo-2,3-diphenylpropanoate (PubChem CID 2750815) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 3-oxo-2,3-diphenylpropanoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-oxo-2,3-diphenylpropanoate |
|---|---|
| PubChem CID | 2750815 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-oxo-2,3-diphenylpropanoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C(C(=O)c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C25H30O3/c1-17(2)21-15-14-18(3)16-22(21)28-25(27)23(19-10-6-4-7-11-19)24(26)20-12-8-5-9-13-20/h4-13,17-18,21-23H,14-16H2,1-3H3 |
| InChIKey | KDOGLUYAIRIKLJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|