C26H31BrO3 — CID 25150374
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-[(4-bromophenyl)methyl]-3-oxo-3-phenylpropanoate (PubChem CID 25150374) has the molecular formula C26H31BrO3 and a molecular weight of 471.44 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-[(4-bromophenyl)methyl]-3-oxo-3-phenylpropanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-[(4-bromophenyl)methyl]-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 25150374 |
| Molecular Formula | C26H31BrO3 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-[(4-bromophenyl)methyl]-3-oxo-3-phenylpropanoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)[C@@H](Cc1ccc(Br)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H31BrO3/c1-17(2)22-14-9-18(3)15-24(22)30-26(29)23(16-19-10-12-21(27)13-11-19)25(28)20-7-5-4-6-8-20/h4-8,10-13,17-18,22-24H,9,14-16H2,1-3H3/t18-,22+,23+,24-/m1/s1 |
| InChIKey | YCOKNYYAZLAHLS-IBURTVSXSA-N |
| XLogP | 6.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|