C37H56O2Sn — CID 177460154
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3S)-3-[dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]stannyl]-2,3-diphenylpropanoate (PubChem CID 177460154) has the molecular formula C37H56O2Sn and a molecular weight of 651.56 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3S)-3-[dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]stannyl]-2,3-diphenylpropanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3S)-3-[dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]stannyl]-2,3-diphenylpropanoate |
|---|---|
| PubChem CID | 177460154 |
| Molecular Formula | C37H56O2Sn |
| Molecular Weight | 651.56 g/mol |
| Exact Mass | 652.33 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3S)-3-[dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]stannyl]-2,3-diphenylpropanoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1[Sn](C)(C)[C@H](c1ccccc1)[C@H](C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H31O2.C10H19.2CH3.Sn/c1-18(2)22-15-14-19(3)16-24(22)27-25(26)23(21-12-8-5-9-13-21)17-20-10-6-4-7-11-20;1-8(2)10-6-4-9(3)5-7-10;;;/h4-13,17-19,22-24H,14-16H2,1-3H3;6,8-10H,4-5,7H2,1-3H3;2*1H3;/t19-,22+,23+,24-;9-,10-;;;/m10.../s1 |
| InChIKey | JFDAXBPQAQMGPM-SILZUBNCSA-N |
| XLogP | 10.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.56 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |